EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H38N4O4 |
| Net Charge | 0 |
| Average Mass | 554.691 |
| Monoisotopic Mass | 554.28931 |
| SMILES | C[C@H]1CN([C@@H](C)CO)C(=O)c2c(c3ccccc3n2C)-c2ccccc2CO[C@@H]1CN(C)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C33H38N4O4/c1-22-18-37(23(2)20-38)32(39)31-30(27-16-10-11-17-28(27)36(31)4)26-15-9-8-12-24(26)21-41-29(22)19-35(3)33(40)34-25-13-6-5-7-14-25/h5-17,22-23,29,38H,18-21H2,1-4H3,(H,34,40)/t22-,23-,29+/m0/s1 |
| InChIKey | HMXYYXXTDVGKHF-SBZVUBOMSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| LSM-30855 (CHEBI:119406) is a indolyl carboxylic acid (CHEBI:46867) |
| Manual Xrefs | Databases |
|---|---|
| LSM-30855 | LINCS |