EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H44N4O4 |
| Net Charge | 0 |
| Average Mass | 548.728 |
| Monoisotopic Mass | 548.33626 |
| SMILES | CC(C)[C@@H](C)NC(=O)N(C)C[C@H]1OCc2ccccc2-c2c(n(C)c3ccccc23)C(=O)N([C@H](C)CO)C[C@@H]1C |
| InChI | InChI=1S/C32H44N4O4/c1-20(2)23(5)33-32(39)34(6)17-28-21(3)16-36(22(4)18-37)31(38)30-29(25-13-9-8-12-24(25)19-40-28)26-14-10-11-15-27(26)35(30)7/h8-15,20-23,28,37H,16-19H2,1-7H3,(H,33,39)/t21-,22+,23+,28+/m0/s1 |
| InChIKey | BIOSPGAGQAHCPR-TUEWKVEFSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| LSM-30781 (CHEBI:119332) is a indolyl carboxylic acid (CHEBI:46867) |
| Manual Xrefs | Databases |
|---|---|
| LSM-30781 | LINCS |