EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H35N3O5 |
| Net Charge | 0 |
| Average Mass | 493.604 |
| Monoisotopic Mass | 493.25767 |
| SMILES | COC(=O)N(C)C[C@@H]1OCc2ccccc2-c2c(n(C)c3ccccc23)C(=O)N([C@@H](C)CO)C[C@@H]1C |
| InChI | InChI=1S/C28H35N3O5/c1-18-14-31(19(2)16-32)27(33)26-25(22-12-8-9-13-23(22)30(26)4)21-11-7-6-10-20(21)17-36-24(18)15-29(3)28(34)35-5/h6-13,18-19,24,32H,14-17H2,1-5H3/t18-,19-,24-/m0/s1 |
| InChIKey | LYNAFNWAMBCYIK-JXQFQVJHSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| LSM-30749 (CHEBI:119300) is a indolyl carboxylic acid (CHEBI:46867) |
| Manual Xrefs | Databases |
|---|---|
| LSM-30749 | LINCS |