EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H39N3O3 |
| Net Charge | 0 |
| Average Mass | 489.660 |
| Monoisotopic Mass | 489.29914 |
| SMILES | C[C@@H]1CN([C@H](C)CO)C(=O)c2c(c3ccccc3n2C)-c2ccccc2CO[C@@H]1CN(C)CC1CC1 |
| InChI | InChI=1S/C30H39N3O3/c1-20-15-33(21(2)18-34)30(35)29-28(25-11-7-8-12-26(25)32(29)4)24-10-6-5-9-23(24)19-36-27(20)17-31(3)16-22-13-14-22/h5-12,20-22,27,34H,13-19H2,1-4H3/t20-,21-,27-/m1/s1 |
| InChIKey | LKZZFECXVBIFRU-LGVUCKNBSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| LSM-30681 (CHEBI:119232) is a indolyl carboxylic acid (CHEBI:46867) |
| Manual Xrefs | Databases |
|---|---|
| LSM-30681 | LINCS |