EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H10N2O |
| Net Charge | 0 |
| Average Mass | 174.203 |
| Monoisotopic Mass | 174.07931 |
| SMILES | O/N=C/Cc1cnc2ccccc12 |
| InChI | InChI=1S/C10H10N2O/c13-12-6-5-8-7-11-10-4-2-1-3-9(8)10/h1-4,6-7,11,13H,5H2/b12-6+ |
| InChIKey | ZLIGRGHTISHYNH-WUXMJOGZSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (E)-indol-3-ylacetaldehyde oxime (CHEBI:17545) is a indol-3-ylacetaldehyde oxime (CHEBI:28311) |
| IUPAC Name |
|---|
| N-[(1E)-2-(1H-indol-3-yl)ethylidene]hydroxylamine |
| Synonym | Source |
|---|---|
| (E)-indol-3-ylacetaldoxime | ChEBI |
| UniProt Name | Source |
|---|---|
| (E)-(indol-3-yl)acetaldehyde oxime | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00000110 | KNApSAcK |
| C02937 | KEGG COMPOUND |
| FDB030141 | FooDB |
| HMDB0303989 | HMDB |
| INDOLE-3-ACETALDOXIME | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4989545 | Reaxys |
| Beilstein:4989545 | Beilstein |
| CAS:2776-06-9 | KEGG COMPOUND |
| Citations |
|---|