EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H9N3O2 |
| Net Charge | 0 |
| Average Mass | 131.135 |
| Monoisotopic Mass | 131.06948 |
| SMILES | N=C(N)NCCC(=O)O |
| InChI | InChI=1S/C4H9N3O2/c5-4(6)7-2-1-3(8)9/h1-2H2,(H,8,9)(H4,5,6,7) |
| InChIKey | KMXXSJLYVJEBHI-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. hypoglycemic agent A drug which lowers the blood glucose level. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-guanidinopropanoic acid (CHEBI:15968) has functional parent propionic acid (CHEBI:30768) |
| 3-guanidinopropanoic acid (CHEBI:15968) has role antineoplastic agent (CHEBI:35610) |
| 3-guanidinopropanoic acid (CHEBI:15968) has role hypoglycemic agent (CHEBI:35526) |
| 3-guanidinopropanoic acid (CHEBI:15968) is a guanidines (CHEBI:24436) |
| 3-guanidinopropanoic acid (CHEBI:15968) is tautomer of 3-guanidinopropanoic acid zwitterion (CHEBI:57593) |
| Incoming Relation(s) |
| 3-guanidinopropanoic acid zwitterion (CHEBI:57593) is tautomer of 3-guanidinopropanoic acid (CHEBI:15968) |
| IUPAC Name |
|---|
| 3-carbamimidamidopropanoic acid |
| INN | Source |
|---|---|
| ompenaclid | WHO MedNet |
| Synonyms | Source |
|---|---|
| 3-Guanidinopropanoate | KEGG COMPOUND |
| 3-guanidino-propionic acid | ChEMBL |
| Amidino beta-alanine | ChEMBL |
| N-[amino(imino)methyl]-β-alanine | ChEBI |
| N-carbamimidoyl-.beta.-alanine | ChEMBL |
| ompenaclid | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| C03065 | KEGG COMPOUND |
| C03065 | KEGG COMPOUND |
| Guanidinopropionic_acid | Wikipedia |
| HMDB0013222 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1705262 | Reaxys |
| CAS:353-09-3 | ChemIDplus |
| Citations |
|---|