EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:16122 - 3-(4-hydroxy-3,5-diiodophenyl)lactic acid
| Formula | C9H8I2O4 |
| Net Charge | 0 |
| Average Mass | 433.967 |
| Monoisotopic Mass | 433.85120 |
| SMILES | O=C(O)C(O)Cc1cc(I)c(O)c(I)c1 |
| InChI | InChI=1S/C9H8I2O4/c10-5-1-4(2-6(11)8(5)13)3-7(12)9(14)15/h1-2,7,12-13H,3H2,(H,14,15) |
| InChIKey | ZPJHINFPRQWKIH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-(4-hydroxy-3,5-diiodophenyl)lactic acid (CHEBI:16122) has functional parent 2-hydroxypropanoic acid (CHEBI:78320) |
| 3-(4-hydroxy-3,5-diiodophenyl)lactic acid (CHEBI:16122) is a 2-hydroxy monocarboxylic acid (CHEBI:49302) |
| 3-(4-hydroxy-3,5-diiodophenyl)lactic acid (CHEBI:16122) is a organoiodine compound (CHEBI:37142) |
| 3-(4-hydroxy-3,5-diiodophenyl)lactic acid (CHEBI:16122) is a phenols (CHEBI:33853) |
| 3-(4-hydroxy-3,5-diiodophenyl)lactic acid (CHEBI:16122) is conjugate acid of 3-(4-hydroxy-3,5-diiodophenyl)lactate (CHEBI:57647) |
| Incoming Relation(s) |
| 3-(4-hydroxy-3,5-diiodophenyl)lactate (CHEBI:57647) is conjugate base of 3-(4-hydroxy-3,5-diiodophenyl)lactic acid (CHEBI:16122) |
| IUPAC Name |
|---|
| 2-hydroxy-3-(4-hydroxy-3,5-diiodophenyl)propanoic acid |
| Synonym | Source |
|---|---|
| 3-(3,5-Diiodo-4-hydroxyphenyl)lactate | KEGG COMPOUND |