EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H29NO7 |
| Net Charge | 0 |
| Average Mass | 491.540 |
| Monoisotopic Mass | 491.19440 |
| SMILES | COC(=O)c1ccc(C2C(Oc3ccc(OC)cc3)C(=O)N2CCc2ccc(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C28H29NO7/c1-32-21-10-12-22(13-11-21)36-26-25(19-6-8-20(9-7-19)28(31)35-4)29(27(26)30)16-15-18-5-14-23(33-2)24(17-18)34-3/h5-14,17,25-26H,15-16H2,1-4H3 |
| InChIKey | NJTVDSRJSONYRA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-[1-[2-(3,4-dimethoxyphenyl)ethyl]-3-(4-methoxyphenoxy)-4-oxo-2-azetidinyl]benzoic acid methyl ester (CHEBI:117206) is a monobactam (CHEBI:50695) |
| Manual Xrefs | Databases |
|---|---|
| LSM-28655 | LINCS |