EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H21ClN2O3 |
| Net Charge | 0 |
| Average Mass | 336.819 |
| Monoisotopic Mass | 336.12407 |
| SMILES | CC1=C(C(=O)OCC(C)C)C(c2ccccc2Cl)NC(=O)N1C |
| InChI | InChI=1S/C17H21ClN2O3/c1-10(2)9-23-16(21)14-11(3)20(4)17(22)19-15(14)12-7-5-6-8-13(12)18/h5-8,10,15H,9H2,1-4H3,(H,19,22) |
| InChIKey | WCWVXPGDIKVTPC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-(2-chlorophenyl)-3,4-dimethyl-2-oxo-1,6-dihydropyrimidine-5-carboxylic acid 2-methylpropyl ester (CHEBI:117151) is a pyrimidinecarboxylic acid (CHEBI:78574) |
| Manual Xrefs | Databases |
|---|---|
| LSM-28600 | LINCS |