EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H8BrN3OS |
| Net Charge | 0 |
| Average Mass | 310.176 |
| Monoisotopic Mass | 308.95714 |
| SMILES | O=C(NN=Cc1ccc(Br)s1)c1ccccn1 |
| InChI | InChI=1S/C11H8BrN3OS/c12-10-5-4-8(17-10)7-14-15-11(16)9-3-1-2-6-13-9/h1-7H,(H,15,16) |
| InChIKey | GLYFDHRNAYDSSU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-[(5-bromo-2-thiophenyl)methylideneamino]-2-pyridinecarboxamide (CHEBI:117149) is a aromatic carboxylic acid (CHEBI:33859) |
| N-[(5-bromo-2-thiophenyl)methylideneamino]-2-pyridinecarboxamide (CHEBI:117149) is a pyridinemonocarboxylic acid (CHEBI:26420) |
| Manual Xrefs | Databases |
|---|---|
| LSM-28598 | LINCS |