EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H23ClN2O7S |
| Net Charge | 0 |
| Average Mass | 518.975 |
| Monoisotopic Mass | 518.09145 |
| SMILES | CCN(c1ccccc1)S(=O)(=O)c1ccc(Cl)c(NC(=O)COC(=O)c2cccc(OC)c2O)c1 |
| InChI | InChI=1S/C24H23ClN2O7S/c1-3-27(16-8-5-4-6-9-16)35(31,32)17-12-13-19(25)20(14-17)26-22(28)15-34-24(30)18-10-7-11-21(33-2)23(18)29/h4-14,29H,3,15H2,1-2H3,(H,26,28) |
| InChIKey | ZOXPMPMPLQXDNO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-hydroxy-3-methoxybenzoic acid [2-[2-chloro-5-[ethyl(phenyl)sulfamoyl]anilino]-2-oxoethyl] ester (CHEBI:117094) is a methoxybenzoic acid (CHEBI:25238) |
| Manual Xrefs | Databases |
|---|---|
| LSM-28541 | LINCS |