EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H21N3O4S |
| Net Charge | 0 |
| Average Mass | 351.428 |
| Monoisotopic Mass | 351.12528 |
| SMILES | COC(=O)c1ccc(C(=O)OC)c(NC(=S)N2CCN(C)CC2)c1 |
| InChI | InChI=1S/C16H21N3O4S/c1-18-6-8-19(9-7-18)16(24)17-13-10-11(14(20)22-2)4-5-12(13)15(21)23-3/h4-5,10H,6-9H2,1-3H3,(H,17,24) |
| InChIKey | MJOUQLXHYGATDU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | endocrine disruptor Any compound that can disrupt the functions of the endocrine (hormone) system |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-[[(4-methyl-1-piperazinyl)-sulfanylidenemethyl]amino]benzene-1,4-dicarboxylic acid dimethyl ester (CHEBI:116971) is a phthalate ester (CHEBI:35484) |
| Manual Xrefs | Databases |
|---|---|
| LSM-28419 | LINCS |