EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H23NO5 |
| Net Charge | 0 |
| Average Mass | 429.472 |
| Monoisotopic Mass | 429.15762 |
| SMILES | CCOc1ccc(C(=O)NCC(=O)OCC(=O)c2ccc3c(c2)-c2ccccc2C3)cc1 |
| InChI | InChI=1S/C26H23NO5/c1-2-31-21-11-9-17(10-12-21)26(30)27-15-25(29)32-16-24(28)20-8-7-19-13-18-5-3-4-6-22(18)23(19)14-20/h3-12,14H,2,13,15-16H2,1H3,(H,27,30) |
| InChIKey | RBKZERXXLBFHKS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-[[(4-ethoxyphenyl)-oxomethyl]amino]acetic acid [2-(9H-fluoren-3-yl)-2-oxoethyl] ester (CHEBI:116814) is a fluorenes (CHEBI:24059) |
| Manual Xrefs | Databases |
|---|---|
| LSM-28265 | LINCS |