EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H14N4O3S |
| Net Charge | 0 |
| Average Mass | 342.380 |
| Monoisotopic Mass | 342.07866 |
| SMILES | CC(NC(=O)c1ccco1)C(=O)Nc1nc(-c2ccccn2)cs1 |
| InChI | InChI=1S/C16H14N4O3S/c1-10(18-15(22)13-6-4-8-23-13)14(21)20-16-19-12(9-24-16)11-5-2-3-7-17-11/h2-10H,1H3,(H,18,22)(H,19,20,21) |
| InChIKey | WCQJJOIGIVFMKQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-[1-oxo-1-[[4-(2-pyridinyl)-2-thiazolyl]amino]propan-2-yl]-2-furancarboxamide (CHEBI:116806) is a N-acyl-amino acid (CHEBI:51569) |
| Manual Xrefs | Databases |
|---|---|
| LSM-28258 | LINCS |