EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H27FN4O |
| Net Charge | 0 |
| Average Mass | 418.516 |
| Monoisotopic Mass | 418.21689 |
| SMILES | CCn1cc(CN2CCc3c(nc4ccccc34)C2c2ccc(F)c(OC)c2)c(C)n1 |
| InChI | InChI=1S/C25H27FN4O/c1-4-30-15-18(16(2)28-30)14-29-12-11-20-19-7-5-6-8-22(19)27-24(20)25(29)17-9-10-21(26)23(13-17)31-3/h5-10,13,15,25,27H,4,11-12,14H2,1-3H3 |
| InChIKey | DPXMBHSCQSNZNF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-[(1-ethyl-3-methyl-4-pyrazolyl)methyl]-1-(4-fluoro-3-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole (CHEBI:116758) is a harmala alkaloid (CHEBI:61379) |
| Manual Xrefs | Databases |
|---|---|
| LSM-28210 | LINCS |