EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:116735 - benzocaine
| Formula | C9H11NO2 |
| Net Charge | 0 |
| Average Mass | 165.192 |
| Monoisotopic Mass | 165.07898 |
| SMILES | CCOC(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C9H11NO2/c1-2-12-9(11)7-3-5-8(10)6-4-7/h3-6H,2,10H2,1H3 |
| InChIKey | BLFLLBZGZJTVJG-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | lubricant Any chemical that reduces friction between surfaces in physical contact. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. anti-obesity agent Any substance which is used to reduce or control weight. sensitiser A chemical compound that causes a substantial proportion of exposed people or animals to develop an allergic reaction in normal tissue after repeated exposure to the compound. |
| Applications: | antipruritic drug A drug, usually applied topically, that relieves pruritus (itching). anaesthetic Substance which produces loss of feeling or sensation. anti-inflammatory agent Any compound that has anti-inflammatory effects. topical anaesthetic A local anesthetic that is used to numb the surface of a body part. analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. nasal decongestant A drug used to relieve nasal congestion in the upper respiratory tract. dermatologic drug A drug used to treat or prevent skin disorders or for the routine care of skin. anti-asthmatic agent Any compound that has anti-asthmatic effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| benzocaine (CHEBI:116735) has role allergen (CHEBI:50904) |
| benzocaine (CHEBI:116735) has role anaesthetic (CHEBI:38867) |
| benzocaine (CHEBI:116735) has role analgesic (CHEBI:35480) |
| benzocaine (CHEBI:116735) has role anti-asthmatic agent (CHEBI:65023) |
| benzocaine (CHEBI:116735) has role anti-inflammatory agent (CHEBI:67079) |
| benzocaine (CHEBI:116735) has role anti-obesity agent (CHEBI:74518) |
| benzocaine (CHEBI:116735) has role antipruritic drug (CHEBI:59683) |
| benzocaine (CHEBI:116735) has role dermatologic drug (CHEBI:50177) |
| benzocaine (CHEBI:116735) has role lubricant (CHEBI:747329) |
| benzocaine (CHEBI:116735) has role nasal decongestant (CHEBI:77715) |
| benzocaine (CHEBI:116735) has role sensitiser (CHEBI:139492) |
| benzocaine (CHEBI:116735) has role topical anaesthetic (CHEBI:48425) |
| benzocaine (CHEBI:116735) is a benzoate ester (CHEBI:36054) |
| benzocaine (CHEBI:116735) is a substituted aniline (CHEBI:48975) |
| IUPAC Name |
|---|
| ethyl 4-aminobenzoate |
| INNs | Source |
|---|---|
| Benzocaina | ChemIDplus |
| Benzocaine | ChemIDplus |
| Benzocainum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 4-aminobenzoic acid ethyl ester | ChEBI |
| Amben ethyl ester | NIST Chemistry WebBook |
| Anaesthesin | ChEMBL |
| AR-01 | ChEMBL |
| AR01 | ChEMBL |
| Ethyl aminobenzoate | KEGG COMPOUND |
| Brand Names | Source |
|---|---|
| Aezodent | ChEMBL |
| Anthisan plus | ChEMBL |
| Baby anbesol | ChEMBL |
| Burneze | ChEMBL |
| Children's chloraseptic | ChEMBL |
| Dequacaine | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 323 | DrugCentral |
| Benzocaine | Wikipedia |
| C07527 | KEGG COMPOUND |
| D00552 | KEGG DRUG |
| DB01086 | DrugBank |
| HMDB0004992 | HMDB |
| LSM-5830 | LINCS |
| Citations |
|---|