EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H11NO2 |
| Net Charge | 0 |
| Average Mass | 165.192 |
| Monoisotopic Mass | 165.07898 |
| SMILES | CCOC(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C9H11NO2/c1-2-12-9(11)7-3-5-8(10)6-4-7/h3-6H,2,10H2,1H3 |
| InChIKey | BLFLLBZGZJTVJG-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | sensitiser A chemical compound that causes a substantial proportion of exposed people or animals to develop an allergic reaction in normal tissue after repeated exposure to the compound. allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. |
| Applications: | topical anaesthetic A local anesthetic that is used to numb the surface of a body part. antipruritic drug A drug, usually applied topically, that relieves pruritus (itching). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| benzocaine (CHEBI:116735) has role allergen (CHEBI:50904) |
| benzocaine (CHEBI:116735) has role antipruritic drug (CHEBI:59683) |
| benzocaine (CHEBI:116735) has role sensitiser (CHEBI:139492) |
| benzocaine (CHEBI:116735) has role topical anaesthetic (CHEBI:48425) |
| benzocaine (CHEBI:116735) is a benzoate ester (CHEBI:36054) |
| benzocaine (CHEBI:116735) is a substituted aniline (CHEBI:48975) |
| IUPAC Name |
|---|
| ethyl 4-aminobenzoate |
| INNs | Source |
|---|---|
| Benzocaina | ChemIDplus |
| Benzocaine | ChemIDplus |
| Benzocainum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 4-aminobenzoic acid ethyl ester | ChEBI |
| Amben ethyl ester | NIST Chemistry WebBook |
| Ethyl aminobenzoate | KEGG COMPOUND |
| Ethyl p-aminobenzoate | NIST Chemistry WebBook |
| Ethyl p-aminophenylcarboxylate | NIST Chemistry WebBook |
| p-Carbethoxyaniline | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| 323 | DrugCentral |
| Benzocaine | Wikipedia |
| C07527 | KEGG COMPOUND |
| D00552 | KEGG DRUG |
| DB01086 | DrugBank |
| HMDB0004992 | HMDB |
| LSM-5830 | LINCS |
| Citations |
|---|