EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H31FN4O3 |
| Net Charge | 0 |
| Average Mass | 514.601 |
| Monoisotopic Mass | 514.23802 |
| SMILES | COc1ccc(C2NC(C(=O)O)Cc3c2nc2ccccc32)cc1CN1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C30H31FN4O3/c1-38-27-11-6-19(16-20(27)18-34-12-14-35(15-13-34)22-9-7-21(31)8-10-22)28-29-24(17-26(33-28)30(36)37)23-4-2-3-5-25(23)32-29/h2-11,16,26,28,32-33H,12-15,17-18H2,1H3,(H,36,37) |
| InChIKey | NMHUDCOGYBAHCI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-[3-[[4-(4-fluorophenyl)-1-piperazinyl]methyl]-4-methoxyphenyl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylic acid (CHEBI:116680) is a harmala alkaloid (CHEBI:61379) |
| Manual Xrefs | Databases |
|---|---|
| LSM-28135 | LINCS |