EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H15F3N2O3 |
| Net Charge | 0 |
| Average Mass | 328.290 |
| Monoisotopic Mass | 328.10348 |
| SMILES | COc1cccc(C(=O)NN=C2CCCC2C(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C15H15F3N2O3/c1-23-10-5-2-4-9(8-10)14(22)20-19-12-7-3-6-11(12)13(21)15(16,17)18/h2,4-5,8,11H,3,6-7H2,1H3,(H,20,22) |
| InChIKey | QQLZMJUYUNOJOL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| LSM-28055 (CHEBI:116600) is a benzoic acids (CHEBI:22723) |
| Manual Xrefs | Databases |
|---|---|
| LSM-28055 | LINCS |