EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H21FN2O7S |
| Net Charge | 0 |
| Average Mass | 464.471 |
| Monoisotopic Mass | 464.10535 |
| SMILES | CCOC(=O)C1=C(CS(=O)(=O)c2ccc(F)c(C)c2)NC(=O)NC1c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C21H21FN2O7S/c1-3-31-20(27)18-15(10-32(29,30)13-5-6-14(22)11(2)8-13)23-21(28)24-19(18)12-4-7-16(25)17(26)9-12/h4-9,19,25-26H,3,10H2,1-2H3,(H2,23,24,28) |
| InChIKey | NPTIRTKTUKFTHJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-(3,4-dihydroxyphenyl)-6-[(4-fluoro-3-methylphenyl)sulfonylmethyl]-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylic acid ethyl ester (CHEBI:116563) is a pyrimidinecarboxylic acid (CHEBI:78574) |
| Manual Xrefs | Databases |
|---|---|
| LSM-28018 | LINCS |