EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:116509 - diuron
| Formula | C9H10Cl2N2O |
| Net Charge | 0 |
| Average Mass | 233.098 |
| Monoisotopic Mass | 232.01702 |
| SMILES | CN(C)C(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C9H10Cl2N2O/c1-13(2)9(14)12-6-3-4-7(10)8(11)5-6/h3-5H,1-2H3,(H,12,14) |
| InChIKey | XMTQQYYKAHVGBJ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Roles: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Applications: | urea herbicide Any herbicide composed of urea or substituted urea substructure. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| diuron (CHEBI:116509) has role environmental contaminant (CHEBI:78298) |
| diuron (CHEBI:116509) has role mitochondrial respiratory-chain inhibitor (CHEBI:25355) |
| diuron (CHEBI:116509) has role photosystem-II inhibitor (CHEBI:26089) |
| diuron (CHEBI:116509) has role urea herbicide (CHEBI:188147) |
| diuron (CHEBI:116509) has role xenobiotic (CHEBI:35703) |
| diuron (CHEBI:116509) is a 3-(3,4-substituted-phenyl)-1,1-dimethylurea (CHEBI:157693) |
| diuron (CHEBI:116509) is a dichlorobenzene (CHEBI:23697) |
| IUPAC Name |
|---|
| 3-(3,4-dichlorophenyl)-1,1-dimethylurea |
| Synonyms | Source |
|---|---|
| 3-(3,4-Dichloro-phenyl)-1,1-dimethyl-urea | ChEMBL |
| 3-(3,4-Dichlor-phenyl)-1,1-dimethyl-harnstoff | ChemIDplus |
| 1-(3,4-dichlorophenyl)-3,3-dimethylurea | ChemIDplus |
| 1-(3,4-dichlorophenyl)-3,3-dimethyluree | ChemIDplus |
| 1,1-dimethyl-3-(3,4-dichlorophenyl)urea | ChemIDplus |
| N-(3,4-dichlorophenyl)-N',N'-dimethylurea | ChemIDplus |
| UniProt Name | Source |
|---|---|
| diuron | UniProt |
| Citations |
|---|