EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H21N5O4S |
| Net Charge | 0 |
| Average Mass | 499.552 |
| Monoisotopic Mass | 499.13143 |
| SMILES | COC(=O)c1cccc(NC(=O)CSc2nnc(COc3ccc(C#N)cc3)n2-c2ccccc2)c1 |
| InChI | InChI=1S/C26H21N5O4S/c1-34-25(33)19-6-5-7-20(14-19)28-24(32)17-36-26-30-29-23(31(26)21-8-3-2-4-9-21)16-35-22-12-10-18(15-27)11-13-22/h2-14H,16-17H2,1H3,(H,28,32) |
| InChIKey | ODLZATUUFMMQHH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-[[2-[[5-[(4-cyanophenoxy)methyl]-4-phenyl-1,2,4-triazol-3-yl]thio]-1-oxoethyl]amino]benzoic acid methyl ester (CHEBI:116487) is a amidobenzoic acid (CHEBI:48470) |
| Manual Xrefs | Databases |
|---|---|
| LSM-27942 | LINCS |