EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H13BrN2O |
| Net Charge | 0 |
| Average Mass | 377.241 |
| Monoisotopic Mass | 376.02113 |
| SMILES | O=C(NN=C1c2ccccc2-c2ccccc21)c1ccccc1Br |
| InChI | InChI=1S/C20H13BrN2O/c21-18-12-6-5-11-17(18)20(24)23-22-19-15-9-3-1-7-13(15)14-8-2-4-10-16(14)19/h1-12H,(H,23,24) |
| InChIKey | HVMJEUBSNOSYSA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-bromo-N-(9-fluorenylideneamino)benzamide (CHEBI:116382) is a fluorenes (CHEBI:24059) |
| Manual Xrefs | Databases |
|---|---|
| LSM-27836 | LINCS |