EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H4O5 |
| Net Charge | -2 |
| Average Mass | 144.082 |
| Monoisotopic Mass | 144.00697 |
| SMILES | O=C([O-])CCC(=O)C(=O)[O-] |
| InChI | InChI=1S/C5H6O5/c6-3(5(9)10)1-2-4(7)8/h1-2H2,(H,7,8)(H,9,10)/p-2 |
| InChIKey | KPGXRSRHYNQIFN-UHFFFAOYSA-L |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chlamydomonas reinhardtii (ncbitaxon:3055) | - | PubMed (25515814) | |
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). |
| Application: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-oxoglutarate(2−) (CHEBI:16810) has functional parent glutarate(2−) (CHEBI:30921) |
| 2-oxoglutarate(2−) (CHEBI:16810) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| 2-oxoglutarate(2−) (CHEBI:16810) has role algal metabolite (CHEBI:84735) |
| 2-oxoglutarate(2−) (CHEBI:16810) has role geroprotector (CHEBI:176497) |
| 2-oxoglutarate(2−) (CHEBI:16810) has role human metabolite (CHEBI:77746) |
| 2-oxoglutarate(2−) (CHEBI:16810) is a oxo dicarboxylate (CHEBI:36147) |
| 2-oxoglutarate(2−) (CHEBI:16810) is conjugate base of 2-oxoglutarate(1−) (CHEBI:30916) |
| Incoming Relation(s) |
| 2-oxoglutarate(1−) (CHEBI:30916) is conjugate acid of 2-oxoglutarate(2−) (CHEBI:16810) |
| IUPAC Name |
|---|
| 2-oxopentanedioate |
| Synonyms | Source |
|---|---|
| 2-ketoglutarate | ChEBI |
| 2-oxopentanedioic acid, ion(2−) | ChemIDplus |
| α-ketoglutarate | ChEBI |
| UniProt Name | Source |
|---|---|
| 2-oxoglutarate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 2-KETOGLUTARATE | MetaCyc |
| C00026 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3664503 | Reaxys |
| Gmelin:602479 | Gmelin |
| CAS:64-15-3 | ChemIDplus |
| Citations |
|---|