EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H10N2O4S |
| Net Charge | 0 |
| Average Mass | 254.267 |
| Monoisotopic Mass | 254.03613 |
| SMILES | NC(=O)SCC(=O)Nc1ccccc1C(=O)O |
| InChI | InChI=1S/C10H10N2O4S/c11-10(16)17-5-8(13)12-7-4-2-1-3-6(7)9(14)15/h1-4H,5H2,(H2,11,16)(H,12,13)(H,14,15) |
| InChIKey | NWUAPELPCMQTDN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-[[2-(carbamoylthio)-1-oxoethyl]amino]benzoic acid (CHEBI:116318) is a amidobenzoic acid (CHEBI:48470) |
| Manual Xrefs | Databases |
|---|---|
| LSM-27772 | LINCS |