EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H5NO3 |
| Net Charge | 0 |
| Average Mass | 139.110 |
| Monoisotopic Mass | 139.02694 |
| SMILES | O=[N+]([O-])c1ccccc1O |
| InChI | InChI=1S/C6H5NO3/c8-6-4-2-1-3-5(6)7(9)10/h1-4,8H |
| InChIKey | IQUPABOKLQSFBK-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-nitrophenol (CHEBI:16260) is a 2-nitrophenols (CHEBI:86421) |
| 2-nitrophenol (CHEBI:16260) is conjugate acid of 2-nitrophenolate (CHEBI:57703) |
| Incoming Relation(s) |
| 2-nitrophenyl N-acetyl-α-D-glucosaminide (CHEBI:90327) has functional parent 2-nitrophenol (CHEBI:16260) |
| 2-nitrophenyl N-acetyl-β-D-glucosaminide (CHEBI:90334) has functional parent 2-nitrophenol (CHEBI:16260) |
| 2-nitrophenyl β-D-galactoside (CHEBI:90144) has functional parent 2-nitrophenol (CHEBI:16260) |
| 2-nitrophenyl β-D-glucoside 6-phosphate (CHEBI:91113) has functional parent 2-nitrophenol (CHEBI:16260) |
| 2-nitrophenolate (CHEBI:57703) is conjugate base of 2-nitrophenol (CHEBI:16260) |
| IUPAC Name |
|---|
| 2-nitrophenol |
| Synonyms | Source |
|---|---|
| 2-hydroxynitrobenzene | NIST Chemistry WebBook |
| 2-Nitrophenol | KEGG COMPOUND |
| o-hydroxynitrobenzene | NIST Chemistry WebBook |
| o-nitrophenol | ChemIDplus |
| Citations |
|---|