EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H12Cl2N2O3S2 |
| Net Charge | 0 |
| Average Mass | 379.290 |
| Monoisotopic Mass | 377.96664 |
| SMILES | CCC(OC(=O)c1nsc(Cl)c1Cl)C(=O)NCc1cccs1 |
| InChI | InChI=1S/C13H12Cl2N2O3S2/c1-2-8(12(18)16-6-7-4-3-5-21-7)20-13(19)10-9(14)11(15)22-17-10/h3-5,8H,2,6H2,1H3,(H,16,18) |
| InChIKey | BYVGVYCVFJGXSL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4,5-dichloro-3-isothiazolecarboxylic acid [1-oxo-1-(thiophen-2-ylmethylamino)butan-2-yl] ester (CHEBI:116295) is a aromatic carboxylic acid (CHEBI:33859) |
| 4,5-dichloro-3-isothiazolecarboxylic acid [1-oxo-1-(thiophen-2-ylmethylamino)butan-2-yl] ester (CHEBI:116295) is a thiazoles (CHEBI:48901) |
| Manual Xrefs | Databases |
|---|---|
| LSM-27750 | LINCS |