EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H11FN2O3 |
| Net Charge | 0 |
| Average Mass | 262.240 |
| Monoisotopic Mass | 262.07537 |
| SMILES | O=C(CNC(=O)c1ccco1)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C13H11FN2O3/c14-9-3-5-10(6-4-9)16-12(17)8-15-13(18)11-2-1-7-19-11/h1-7H,8H2,(H,15,18)(H,16,17) |
| InChIKey | AQQZWSKKBHAKCI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-[2-(4-fluoroanilino)-2-oxoethyl]-2-furancarboxamide (CHEBI:116231) is a N-acyl-amino acid (CHEBI:51569) |
| Manual Xrefs | Databases |
|---|---|
| LSM-27686 | LINCS |