EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H15NO5 |
| Net Charge | 0 |
| Average Mass | 289.287 |
| Monoisotopic Mass | 289.09502 |
| SMILES | O=C(COC(=O)C=Cc1ccc2c(c1)OCO2)NC1CC1 |
| InChI | InChI=1S/C15H15NO5/c17-14(16-11-3-4-11)8-19-15(18)6-2-10-1-5-12-13(7-10)21-9-20-12/h1-2,5-7,11H,3-4,8-9H2,(H,16,17) |
| InChIKey | CWEMYEUMTPISEA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-(1,3-benzodioxol-5-yl)-2-propenoic acid [2-(cyclopropylamino)-2-oxoethyl] ester (CHEBI:116150) is a hydroxycinnamic acid (CHEBI:24689) |
| Manual Xrefs | Databases |
|---|---|
| LSM-27606 | LINCS |