EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H42N7O17P3S |
| Net Charge | 0 |
| Average Mass | 849.643 |
| Monoisotopic Mass | 849.15707 |
| SMILES | CC=C(C)C(=O)SCCNC(=O)CCNC(=O)[C@H](O)C(C)(C)COP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1OP(=O)(O)O |
| InChI | InChI=1S/C26H42N7O17P3S/c1-5-14(2)25(38)54-9-8-28-16(34)6-7-29-23(37)20(36)26(3,4)11-47-53(44,45)50-52(42,43)46-10-15-19(49-51(39,40)41)18(35)24(48-15)33-13-32-17-21(27)30-12-31-22(17)33/h5,12-13,15,18-20,24,35-36H,6-11H2,1-4H3,(H,28,34)(H,29,37)(H,42,43)(H,44,45)(H2,27,30,31)(H2,39,40,41)/t15-,18-,19-,20+,24-/m1/s1 |
| InChIKey | PMWATMXOQQZNBX-DJVIHCHSSA-N |
| Roles Classification |
|---|
| Chemical Role: | acyl donor Any donor that can transfer acyl groups between molecular entities. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-methylbut-2-enoyl-coenzyme A (CHEBI:11614) has functional parent 2-methylbut-2-enoic acid (CHEBI:36432) |
| 2-methylbut-2-enoyl-coenzyme A (CHEBI:11614) is a alk-2-enoyl-CoA (CHEBI:15469) |
| 2-methylbut-2-enoyl-coenzyme A (CHEBI:11614) is a monounsaturated fatty acyl-CoA (CHEBI:139575) |
| 2-methylbut-2-enoyl-coenzyme A (CHEBI:11614) is conjugate acid of 2-methylbut-2-enoyl-CoA(4−) (CHEBI:57260) |
| Incoming Relation(s) |
| 2-methylbut-2-enoyl-CoA(4−) (CHEBI:57260) is conjugate base of 2-methylbut-2-enoyl-coenzyme A (CHEBI:11614) |
| IUPAC Name |
|---|
| 3'-phosphoadenosine 5'-[3-(3-hydroxy-2,2-dimethyl-4-{[3-({2-[(2-methylbut-2-enoyl)sulfanyl]ethyl}amino)-3-oxopropyl]amino}-4-oxobutyl) dihydrogen diphosphate] |
| Synonyms | Source |
|---|---|
| 2-methylbut-2-enol-coenzyme A | ChEBI |
| 2-methylcrotonoyl-CoA | ChEBI |
| 2-methylcrotonoyl-coenzyme A | ChEBI |
| 2-methylcrotonyl-CoA | ChEBI |
| 2-methylcrotonyl-coenzyme A | ChEBI |
| Methylcrotonyl-coa | ChemIDplus |