EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H16F6N2O6S |
| Net Charge | 0 |
| Average Mass | 562.444 |
| Monoisotopic Mass | 562.06333 |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(C(OC(=O)c3ccccc3[N+](=O)[O-])(C(F)(F)F)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C23H16F6N2O6S/c1-14-6-12-17(13-7-14)38(35,36)30-16-10-8-15(9-11-16)21(22(24,25)26,23(27,28)29)37-20(32)18-4-2-3-5-19(18)31(33)34/h2-13,30H,1H3 |
| InChIKey | XDJWAOUGFANZTF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-nitrobenzoic acid [1,1,1,3,3,3-hexafluoro-2-[4-[(4-methylphenyl)sulfonylamino]phenyl]propan-2-yl] ester (CHEBI:116121) is a nitrobenzoic acid (CHEBI:25553) |
| Manual Xrefs | Databases |
|---|---|
| LSM-27577 | LINCS |