EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H18N2O2S |
| Net Charge | 0 |
| Average Mass | 350.443 |
| Monoisotopic Mass | 350.10890 |
| SMILES | CC(=NOC(=O)c1cccc(C)c1)c1sc(-c2ccccc2)nc1C |
| InChI | InChI=1S/C20H18N2O2S/c1-13-8-7-11-17(12-13)20(23)24-22-15(3)18-14(2)21-19(25-18)16-9-5-4-6-10-16/h4-12H,1-3H3 |
| InChIKey | RHBWSRQRWUDTTE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-methylbenzoic acid [1-(4-methyl-2-phenyl-5-thiazolyl)ethylideneamino] ester (CHEBI:115677) is a benzoic acids (CHEBI:22723) |
| Manual Xrefs | Databases |
|---|---|
| LSM-27134 | LINCS |