EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H12N2O2S |
| Net Charge | 0 |
| Average Mass | 260.318 |
| Monoisotopic Mass | 260.06195 |
| SMILES | Cc1ccccc1C(N)=NOC(=O)c1cccs1 |
| InChI | InChI=1S/C13H12N2O2S/c1-9-5-2-3-6-10(9)12(14)15-17-13(16)11-7-4-8-18-11/h2-8H,1H3,(H2,14,15) |
| InChIKey | WNHVMJXGJPAPEP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-thiophenecarboxylic acid [[amino-(2-methylphenyl)methylidene]amino] ester (CHEBI:115646) is a thiophenecarboxylic acid (CHEBI:48436) |
| Manual Xrefs | Databases |
|---|---|
| LSM-27103 | LINCS |