EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H27N3O6S |
| Net Charge | 0 |
| Average Mass | 509.584 |
| Monoisotopic Mass | 509.16206 |
| SMILES | COc1ccccc1CNC(=O)COC(=O)c1cccnc1SCC(=O)NCc1ccccc1OC |
| InChI | InChI=1S/C26H27N3O6S/c1-33-21-11-5-3-8-18(21)14-28-23(30)16-35-26(32)20-10-7-13-27-25(20)36-17-24(31)29-15-19-9-4-6-12-22(19)34-2/h3-13H,14-17H2,1-2H3,(H,28,30)(H,29,31) |
| InChIKey | FVPQHDUJMGOBLU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-[[2-[(2-methoxyphenyl)methylamino]-2-oxoethyl]thio]-3-pyridinecarboxylic acid [2-[(2-methoxyphenyl)methylamino]-2-oxoethyl] ester (CHEBI:115549) is a aromatic carboxylic acid (CHEBI:33859) |
| 2-[[2-[(2-methoxyphenyl)methylamino]-2-oxoethyl]thio]-3-pyridinecarboxylic acid [2-[(2-methoxyphenyl)methylamino]-2-oxoethyl] ester (CHEBI:115549) is a pyridines (CHEBI:26421) |
| Manual Xrefs | Databases |
|---|---|
| LSM-27006 | LINCS |