EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H18N4O3S2 |
| Net Charge | 0 |
| Average Mass | 390.490 |
| Monoisotopic Mass | 390.08203 |
| SMILES | CC(C)C(=O)Nc1ccc(C(=O)NNC(=S)NC(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C17H18N4O3S2/c1-10(2)14(22)18-12-7-5-11(6-8-12)15(23)20-21-17(25)19-16(24)13-4-3-9-26-13/h3-10H,1-2H3,(H,18,22)(H,20,23)(H2,19,21,24,25) |
| InChIKey | WVEHKULHEMECDQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-[[[[4-[(2-methyl-1-oxopropyl)amino]phenyl]-oxomethyl]hydrazo]-sulfanylidenemethyl]-2-thiophenecarboxamide (CHEBI:115545) is a amidobenzoic acid (CHEBI:48470) |
| Manual Xrefs | Databases |
|---|---|
| LSM-27002 | LINCS |