EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H16N2OS |
| Net Charge | 0 |
| Average Mass | 284.384 |
| Monoisotopic Mass | 284.09833 |
| SMILES | O=C(NC(=S)NCCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H16N2OS/c19-15(14-9-5-2-6-10-14)18-16(20)17-12-11-13-7-3-1-4-8-13/h1-10H,11-12H2,(H2,17,18,19,20) |
| InChIKey | WTHFYGYKFAIQEO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-[(2-phenylethylamino)-sulfanylidenemethyl]benzamide (CHEBI:115495) is a benzoic acids (CHEBI:22723) |
| Manual Xrefs | Databases |
|---|---|
| LSM-26952 | LINCS |