EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H18O4S2 |
| Net Charge | 0 |
| Average Mass | 338.450 |
| Monoisotopic Mass | 338.06465 |
| SMILES | CCC(C)(c1ccc(C(=O)OC)s1)c1ccc(C(=O)OC)s1 |
| InChI | InChI=1S/C16H18O4S2/c1-5-16(2,12-8-6-10(21-12)14(17)19-3)13-9-7-11(22-13)15(18)20-4/h6-9H,5H2,1-4H3 |
| InChIKey | DXEOUNBMNBYGPG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-[2-(5-methoxycarbonyl-2-thiophenyl)butan-2-yl]-2-thiophenecarboxylic acid methyl ester (CHEBI:115494) is a thiophenecarboxylic acid (CHEBI:48436) |
| Manual Xrefs | Databases |
|---|---|
| LSM-26951 | LINCS |