EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H10N4O4 |
| Net Charge | 0 |
| Average Mass | 286.247 |
| Monoisotopic Mass | 286.07020 |
| SMILES | NC(=NOC(=O)c1ccccc1[N+](=O)[O-])c1ccccn1 |
| InChI | InChI=1S/C13H10N4O4/c14-12(10-6-3-4-8-15-10)16-21-13(18)9-5-1-2-7-11(9)17(19)20/h1-8H,(H2,14,16) |
| InChIKey | CAPDMQCHOWSAMU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-nitrobenzoic acid [[amino(2-pyridinyl)methylidene]amino] ester (CHEBI:115460) is a nitrobenzoic acid (CHEBI:25553) |
| Manual Xrefs | Databases |
|---|---|
| LSM-26917 | LINCS |