EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H5NOS |
| Net Charge | 0 |
| Average Mass | 151.190 |
| Monoisotopic Mass | 151.00918 |
| SMILES | Oc1nc2ccccc2s1 |
| InChI | InChI=1S/C7H5NOS/c9-7-8-5-3-1-2-4-6(5)10-7/h1-4H,(H,8,9) |
| InChIKey | YEDUAINPPJYDJZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Roles: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-hydroxybenzothiazole (CHEBI:115196) is a benzothiazole (CHEBI:45993) |
| IUPAC Name |
|---|
| 1,3-benzothiazol-2-ol |
| Synonyms | Source |
|---|---|
| 3H-Benzothiazol-2-one | ChEMBL |
| HBT | ChEBI |
| 2(3H)-Benzothiazolone | ChemIDplus |
| 2-Benzothiazolol | ChemIDplus |
| 2-Benzothiazolone | ChemIDplus |
| 2-hydroxy-1,3-benzothiazole | ChEBI |
| Citations |
|---|