EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H2O4.2Na |
| Net Charge | 0 |
| Average Mass | 160.036 |
| Monoisotopic Mass | 159.97485 |
| SMILES | O=C([O-])/C=C/C(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C4H4O4.2Na/c5-3(6)1-2-4(7)8;;/h1-2H,(H,5,6)(H,7,8);;/q;2*+1/p-2/b2-1+;; |
| InChIKey | MSJMDZAOKORVFC-SEPHDYHBSA-L |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | food acidity regulator A food additive that is used to change or otherwise control the acidity or alkalinity of foods. They may be acids, bases, neutralising agents or buffering agents. |
| Application: | food acidity regulator A food additive that is used to change or otherwise control the acidity or alkalinity of foods. They may be acids, bases, neutralising agents or buffering agents. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| disodium fumarate (CHEBI:115156) has part fumarate(2−) (CHEBI:29806) |
| disodium fumarate (CHEBI:115156) has role food acidity regulator (CHEBI:64049) |
| disodium fumarate (CHEBI:115156) is a organic sodium salt (CHEBI:38700) |
| IUPAC Name |
|---|
| disodium (2E)-but-2-enedioate |
| Synonyms | Source |
|---|---|
| Fumaric acid, disodium salt | ChemIDplus |
| Sodium fumarate | ChemIDplus |
| E365 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| Sodium_fumarate | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4301302 | Reaxys |
| CAS:17013-01-3 | ChemIDplus |