EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H5NO5 |
| Net Charge | -2 |
| Average Mass | 183.119 |
| Monoisotopic Mass | 183.01787 |
| SMILES | [H]C(=O)C([H])=C([H])C(C(=O)[O-])=C(N)C(=O)[O-] |
| InChI | InChI=1S/C7H7NO5/c8-5(7(12)13)4(6(10)11)2-1-3-9/h1-3H,8H2,(H,10,11)(H,12,13)/p-2 |
| InChIKey | KACPVQQHDVBVFC-UHFFFAOYSA-L |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Biological Role: | Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-amino-3-(3-oxoprop-1-enyl)but-2-enedioate (CHEBI:29044) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| 2-amino-3-(3-oxoprop-1-enyl)but-2-enedioate (CHEBI:29044) is a oxo dicarboxylate (CHEBI:36147) |
| 2-amino-3-(3-oxoprop-1-enyl)but-2-enedioate (CHEBI:29044) is a α-amino-acid anion (CHEBI:33558) |
| 2-amino-3-(3-oxoprop-1-enyl)but-2-enedioate (CHEBI:29044) is conjugate base of 2-amino-3-(3-oxoprop-1-enyl)but-2-enedioic acid (CHEBI:19448) |
| 2-amino-3-(3-oxoprop-1-enyl)but-2-enedioate (CHEBI:29044) is conjugate base of 2-ammonio-3-(3-oxoprop-1-enyl)but-2-enedioate(1−) (CHEBI:77803) |
| Incoming Relation(s) |
| cis,cis-2-amino-3-(3-oxoprop-1-enyl)but-2-enedioate (CHEBI:994) is a 2-amino-3-(3-oxoprop-1-enyl)but-2-enedioate (CHEBI:29044) |
| 2-amino-3-(3-oxoprop-1-enyl)but-2-enedioic acid (CHEBI:19448) is conjugate acid of 2-amino-3-(3-oxoprop-1-enyl)but-2-enedioate (CHEBI:29044) |
| 2-ammonio-3-(3-oxoprop-1-enyl)but-2-enedioate(1−) (CHEBI:77803) is conjugate acid of 2-amino-3-(3-oxoprop-1-enyl)but-2-enedioate (CHEBI:29044) |
| IUPAC Name |
|---|
| 2-amino-3-(3-oxoprop-1-en-1-yl)but-2-enedioate |