EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H35N5O6 |
| Net Charge | 0 |
| Average Mass | 453.540 |
| Monoisotopic Mass | 453.25873 |
| SMILES | CC(C)(C)OC(=O)CNC(=O)c1ncnc1C(=O)NCCCCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H35N5O6/c1-20(2,3)31-14(27)12-24-18(29)16-15(25-13-26-16)17(28)22-10-8-7-9-11-23-19(30)32-21(4,5)6/h13H,7-12H2,1-6H3,(H,22,28)(H,23,30)(H,24,29)(H,25,26) |
| InChIKey | KCVHFGFPHUIUFI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-[[[4-[[5-[[(2-methylpropan-2-yl)oxy-oxomethyl]amino]pentylamino]-oxomethyl]-1H-imidazol-5-yl]-oxomethyl]amino]acetic acid tert-butyl ester (CHEBI:115018) is a N-acyl-amino acid (CHEBI:51569) |
| 2-[[[4-[[5-[[(2-methylpropan-2-yl)oxy-oxomethyl]amino]pentylamino]-oxomethyl]-1H-imidazol-5-yl]-oxomethyl]amino]acetic acid tert-butyl ester (CHEBI:115018) is a tert-butyl ester (CHEBI:140402) |
| Manual Xrefs | Databases |
|---|---|
| LSM-26480 | LINCS |