EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H15NO4S |
| Net Charge | 0 |
| Average Mass | 269.322 |
| Monoisotopic Mass | 269.07218 |
| SMILES | Cc1ccsc1C(=O)OCC(=O)N1CCOCC1 |
| InChI | InChI=1S/C12H15NO4S/c1-9-2-7-18-11(9)12(15)17-8-10(14)13-3-5-16-6-4-13/h2,7H,3-6,8H2,1H3 |
| InChIKey | HSBGEASFQTWFHZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-methyl-2-thiophenecarboxylic acid [2-(4-morpholinyl)-2-oxoethyl] ester (CHEBI:115006) is a thiophenecarboxylic acid (CHEBI:48436) |
| Manual Xrefs | Databases |
|---|---|
| LSM-26468 | LINCS |