EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H18O4 |
| Net Charge | 0 |
| Average Mass | 286.327 |
| Monoisotopic Mass | 286.12051 |
| SMILES | COc1ccc([C@@H]2COc3cc(O)ccc3C2)c(OC)c1 |
| InChI | InChI=1S/C17H18O4/c1-19-14-5-6-15(17(9-14)20-2)12-7-11-3-4-13(18)8-16(11)21-10-12/h3-6,8-9,12,18H,7,10H2,1-2H3/t12-/m0/s1 |
| InChIKey | TUXCLJQCYVCGDW-LBPRGKRZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Baphia nitida (ncbitaxon:162666) | - | DOI (10.1016/0031-9422(92)80059-N) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-sativan (CHEBI:115) has parent hydride (R)-isoflavan (CHEBI:36101) |
| (−)-sativan (CHEBI:115) has role plant metabolite (CHEBI:76924) |
| (−)-sativan (CHEBI:115) is a hydroxyisoflavans (CHEBI:76250) |
| (−)-sativan (CHEBI:115) is a methoxyisoflavan (CHEBI:77002) |
| IUPAC Name |
|---|
| (3R)-3-(2,4-dimethoxyphenyl)-3,4-dihydro-2H-chromen-7-ol |
| Synonyms | Source |
|---|---|
| (3R)-3-(2,4-dimethoxyphenyl)-3,4-dihydro-2H-1-benzopyran-7-ol | ChemIDplus |
| sativin | ChemIDplus |
| 2-hydroxy-2',4'-dimethoxyisoflavan | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1397593 | Reaxys |
| CAS:41743-86-6 | KEGG COMPOUND |
| CAS:41743-86-6 | ChemIDplus |