EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H19N3O5 |
| Net Charge | 0 |
| Average Mass | 369.377 |
| Monoisotopic Mass | 369.13247 |
| SMILES | COc1ccc(C=CC(=O)NCC(=O)NNC=C2C=CC(=O)C=C2O)cc1 |
| InChI | InChI=1S/C19H19N3O5/c1-27-16-7-2-13(3-8-16)4-9-18(25)20-12-19(26)22-21-11-14-5-6-15(23)10-17(14)24/h2-11,21,24H,12H2,1H3,(H,20,25)(H,22,26) |
| InChIKey | SWOOACBSYNSSNU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-[2-[(2-hydroxy-4-oxo-1-cyclohexa-2,5-dienylidene)methylhydrazo]-2-oxoethyl]-3-(4-methoxyphenyl)-2-propenamide (CHEBI:114995) is a N-acyl-amino acid (CHEBI:51569) |
| Manual Xrefs | Databases |
|---|---|
| LSM-26457 | LINCS |