EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H14N2O5 |
| Net Charge | 0 |
| Average Mass | 326.308 |
| Monoisotopic Mass | 326.09027 |
| SMILES | O=C(NCc1ccco1)C(=Cc1ccco1)NC(=O)c1ccco1 |
| InChI | InChI=1S/C17H14N2O5/c20-16(18-11-13-5-2-8-23-13)14(10-12-4-1-7-22-12)19-17(21)15-6-3-9-24-15/h1-10H,11H2,(H,18,20)(H,19,21) |
| InChIKey | YBQNMTCWAUEUQU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-[1-(2-furanyl)-3-(2-furanylmethylamino)-3-oxoprop-1-en-2-yl]-2-furancarboxamide (CHEBI:114932) is a N-acyl-amino acid (CHEBI:51569) |
| Manual Xrefs | Databases |
|---|---|
| LSM-26395 | LINCS |