EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H8ClNO2S2 |
| Net Charge | 0 |
| Average Mass | 285.777 |
| Monoisotopic Mass | 284.96850 |
| SMILES | O=C(O)c1ccc(SCc2cnc(Cl)s2)cc1 |
| InChI | InChI=1S/C11H8ClNO2S2/c12-11-13-5-9(17-11)6-16-8-3-1-7(2-4-8)10(14)15/h1-5H,6H2,(H,14,15) |
| InChIKey | GHMOISZEIKTQDE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-[(2-chloro-5-thiazolyl)methylthio]benzoic acid (CHEBI:114848) is a sulfanylbenzoic acid (CHEBI:59126) |
| Manual Xrefs | Databases |
|---|---|
| LSM-26310 | LINCS |