EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H10O7 |
| Net Charge | 0 |
| Average Mass | 206.150 |
| Monoisotopic Mass | 206.04265 |
| SMILES | O=C(O)CCC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C7H10O7/c8-4(9)1-2-7(14,6(12)13)3-5(10)11/h14H,1-3H2,(H,8,9)(H,10,11)(H,12,13) |
| InChIKey | XKJVEVRQMLKSMO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| homocitric acid (CHEBI:17852) is a tricarboxylic acid (CHEBI:27093) |
| homocitric acid (CHEBI:17852) is conjugate acid of homocitrate(1−) (CHEBI:36459) |
| Incoming Relation(s) |
| 2-hydroxy-4-oxobutane-1,2,4-tricarboxylic acid (CHEBI:17250) has functional parent homocitric acid (CHEBI:17852) |
| (2R)-homocitric acid (CHEBI:52222) is a homocitric acid (CHEBI:17852) |
| (2S)-homocitric acid (CHEBI:143966) is a homocitric acid (CHEBI:17852) |
| homocitrate(1−) (CHEBI:36459) is conjugate base of homocitric acid (CHEBI:17852) |
| IUPAC Name |
|---|
| 2-hydroxybutane-1,2,4-tricarboxylic acid |
| Synonyms | Source |
|---|---|
| 3-Hydroxy-3-carboxyadipic acid | KEGG COMPOUND |
| Homocitric acid | KEGG COMPOUND |