EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H9NO3S |
| Net Charge | 0 |
| Average Mass | 211.242 |
| Monoisotopic Mass | 211.03031 |
| SMILES | CC(=O)CSc1ccc(C(=O)O)cn1 |
| InChI | InChI=1S/C9H9NO3S/c1-6(11)5-14-8-3-2-7(4-10-8)9(12)13/h2-4H,5H2,1H3,(H,12,13) |
| InChIKey | LRBIKSYRCFHKBN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-(2-oxopropylthio)-3-pyridinecarboxylic acid (CHEBI:114650) is a aromatic carboxylic acid (CHEBI:33859) |
| 6-(2-oxopropylthio)-3-pyridinecarboxylic acid (CHEBI:114650) is a pyridines (CHEBI:26421) |
| Manual Xrefs | Databases |
|---|---|
| LSM-26112 | LINCS |