EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H18N4O4 |
| Net Charge | 0 |
| Average Mass | 354.366 |
| Monoisotopic Mass | 354.13281 |
| SMILES | CC(CC(=O)Nc1ccc2c(c1)OCO2)=NNC(=O)c1ccccc1N |
| InChI | InChI=1S/C18H18N4O4/c1-11(21-22-18(24)13-4-2-3-5-14(13)19)8-17(23)20-12-6-7-15-16(9-12)26-10-25-15/h2-7,9H,8,10,19H2,1H3,(H,20,23)(H,22,24) |
| InChIKey | MGBSYVGOLVTBCY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-amino-N-[[4-(1,3-benzodioxol-5-ylamino)-4-oxobutan-2-ylidene]amino]benzamide (CHEBI:114583) is a aminobenzoic acid (CHEBI:22495) |
| Manual Xrefs | Databases |
|---|---|
| LSM-26045 | LINCS |