EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H13N3O2 |
| Net Charge | 0 |
| Average Mass | 255.277 |
| Monoisotopic Mass | 255.10078 |
| SMILES | Cc1cccc(NC(=O)NC(=O)c2ccccc2)n1 |
| InChI | InChI=1S/C14H13N3O2/c1-10-6-5-9-12(15-10)16-14(19)17-13(18)11-7-3-2-4-8-11/h2-9H,1H3,(H2,15,16,17,18,19) |
| InChIKey | BCLLGYXPSYLYTG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-[[(6-methyl-2-pyridinyl)amino]-oxomethyl]benzamide (CHEBI:114579) is a benzoic acids (CHEBI:22723) |
| Manual Xrefs | Databases |
|---|---|
| LSM-26041 | LINCS |